C19H29N3O2S — CID 119139285
N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 119139285) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 119139285 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CC(C)C/N=C(\NCC1CCS(=O)(=O)C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H29N3O2S/c1-15(2)11-20-19(21-12-16-8-10-25(23,24)14-16)22-9-7-17-5-3-4-6-18(17)13-22/h3-6,15-16H,7-14H2,1-2H3,(H,20,21) |
| InChIKey | VYPCALYVUNLEDZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|