C19H28IN3O2S — CID 119115524
N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylprop-2-enyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 119115524) has the molecular formula C19H28IN3O2S and a molecular weight of 489.42 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylprop-2-enyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylprop-2-enyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119115524 |
| Molecular Formula | C19H28IN3O2S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-N'-(2-methylprop-2-enyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | C=C(C)C/N=C(\NCC1CCS(=O)(=O)C1)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C19H27N3O2S.HI/c1-15(2)11-20-19(21-12-16-8-10-25(23,24)14-16)22-9-7-17-5-3-4-6-18(17)13-22;/h3-6,16H,1,7-14H2,2H3,(H,20,21);1H |
| InChIKey | RZRHVHZPTLLQIJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|