C12H20N2O2 — CID 108520564
2-(3,5-dimethylpiperidin-1-yl)-2-oxo-N-prop-2-enylacetamide (PubChem CID 108520564) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-2-oxo-N-prop-2-enylacetamide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-2-oxo-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 108520564 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-2-oxo-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-4-5-13-11(15)12(16)14-7-9(2)6-10(3)8-14/h4,9-10H,1,5-8H2,2-3H3,(H,13,15) |
| InChIKey | VCWBKPABWYETDS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|