C22H41N3O4 — CID 143356601
(2S,4R)-1-acetyl-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-methylpyrrolidine-2-carboxamide;ethane;propane (PubChem CID 143356601) has the molecular formula C22H41N3O4 and a molecular weight of 411.59 g/mol. Its IUPAC name is (2S,4R)-1-acetyl-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-methylpyrrolidine-2-carboxamide;ethane;propane.
| Compound Name | (2S,4R)-1-acetyl-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-methylpyrrolidine-2-carboxamide;ethane;propane |
|---|---|
| PubChem CID | 143356601 |
| Molecular Formula | C22H41N3O4 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (2S,4R)-1-acetyl-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-methylpyrrolidine-2-carboxamide;ethane;propane |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1C[C@@H](C)CN1C(C)=O.CC.CCC |
| InChI | InChI=1S/C17H27N3O4.C3H8.C2H6/c1-5-7-13(15(22)17(24)18-8-6-2)19-16(23)14-9-11(3)10-20(14)12(4)21;1-3-2;1-2/h6,11,13-14H,2,5,7-10H2,1,3-4H3,(H,18,24)(H,19,23);3H2,1-2H3;1-2H3/t11-,13?,14+;;/m1../s1 |
| InChIKey | OJLVKVCYZSAPRF-RYRNNKKGSA-N |
| XLogP | 2.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|