C28H39N3O4 — CID 21017015
1-(2-cyclohexylacetyl)-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-phenylpyrrolidine-2-carboxamide (PubChem CID 21017015) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is 1-(2-cyclohexylacetyl)-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-(2-cyclohexylacetyl)-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 21017015 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 1-(2-cyclohexylacetyl)-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-4-phenylpyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CC(c2ccccc2)CN1C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C28H39N3O4/c1-3-11-23(26(33)28(35)29-16-4-2)30-27(34)24-18-22(21-14-9-6-10-15-21)19-31(24)25(32)17-20-12-7-5-8-13-20/h4,6,9-10,14-15,20,22-24H,2-3,5,7-8,11-13,16-19H2,1H3,(H,29,35)(H,30,34) |
| InChIKey | FTJZIGORBPUVQT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|