C33H41N3O6 — CID 21016604
9H-fluoren-9-ylmethyl 2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate (PubChem CID 21016604) has the molecular formula C33H41N3O6 and a molecular weight of 575.71 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 21016604 |
| Molecular Formula | C33H41N3O6 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-1-carboxylate |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CC(OC(C)(C)C)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H41N3O6/c1-6-12-27(29(37)31(39)34-17-7-2)35-30(38)28-18-21(42-33(3,4)5)19-36(28)32(40)41-20-26-24-15-10-8-13-22(24)23-14-9-11-16-25(23)26/h7-11,13-16,21,26-28H,2,6,12,17-20H2,1,3-5H3,(H,34,39)(H,35,38) |
| InChIKey | YXLAFCLVIOMDTK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|