C31H44N4O5 — CID 58908708
(1R,5S)-3-[3,3-dimethyl-2-[(2-phenylacetyl)amino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 58908708) has the molecular formula C31H44N4O5 and a molecular weight of 552.72 g/mol. Its IUPAC name is (1R,5S)-3-[3,3-dimethyl-2-[(2-phenylacetyl)amino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,5S)-3-[3,3-dimethyl-2-[(2-phenylacetyl)amino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 58908708 |
| Molecular Formula | C31H44N4O5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (1R,5S)-3-[3,3-dimethyl-2-[(2-phenylacetyl)amino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1[C@@H]2[C@H](CN1C(=O)C(NC(=O)Cc1ccccc1)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C31H44N4O5/c1-8-13-21(25(37)28(39)32-16-9-2)33-27(38)24-23-20(31(23,6)7)18-35(24)29(40)26(30(3,4)5)34-22(36)17-19-14-11-10-12-15-19/h9-12,14-15,20-21,23-24,26H,2,8,13,16-18H2,1,3-7H3,(H,32,39)(H,33,38)(H,34,36)/t20-,21?,23-,24?,26?/m0/s1 |
| InChIKey | KIWXKVDBXSBQOI-NFFRLKMCSA-N |
| XLogP | 2.40 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|