C29H50N4O4 — CID 58705447
3-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 58705447) has the molecular formula C29H50N4O4 and a molecular weight of 518.74 g/mol. Its IUPAC name is 3-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | 3-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 58705447 |
| Molecular Formula | C29H50N4O4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | 3-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1C2C(CN1C(=O)C(NCCC(C)(C)C)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C29H50N4O4/c1-11-13-19(22(34)25(36)31-15-12-2)32-24(35)21-20-18(29(20,9)10)17-33(21)26(37)23(28(6,7)8)30-16-14-27(3,4)5/h12,18-21,23,30H,2,11,13-17H2,1,3-10H3,(H,31,36)(H,32,35) |
| InChIKey | LIVZXMPWIOHBGT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|