C24H40N4O6 — CID 143315879
propan-2-yl N-[(2S)-1-[(4R)-2-[[2,3-dioxo-3-(prop-2-enylamino)propyl]carbamoyl]-4-methylpyrrolidin-1-yl]-1-oxooctan-2-yl]carbamate (PubChem CID 143315879) has the molecular formula C24H40N4O6 and a molecular weight of 480.61 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-1-[(4R)-2-[[2,3-dioxo-3-(prop-2-enylamino)propyl]carbamoyl]-4-methylpyrrolidin-1-yl]-1-oxooctan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-1-[(4R)-2-[[2,3-dioxo-3-(prop-2-enylamino)propyl]carbamoyl]-4-methylpyrrolidin-1-yl]-1-oxooctan-2-yl]carbamate |
|---|---|
| PubChem CID | 143315879 |
| Molecular Formula | C24H40N4O6 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | propan-2-yl N-[(2S)-1-[(4R)-2-[[2,3-dioxo-3-(prop-2-enylamino)propyl]carbamoyl]-4-methylpyrrolidin-1-yl]-1-oxooctan-2-yl]carbamate |
| SMILES | C=CCNC(=O)C(=O)CNC(=O)C1C[C@@H](C)CN1C(=O)[C@H](CCCCCC)NC(=O)OC(C)C |
| InChI | InChI=1S/C24H40N4O6/c1-6-8-9-10-11-18(27-24(33)34-16(3)4)23(32)28-15-17(5)13-19(28)21(30)26-14-20(29)22(31)25-12-7-2/h7,16-19H,2,6,8-15H2,1,3-5H3,(H,25,31)(H,26,30)(H,27,33)/t17-,18+,19?/m1/s1 |
| InChIKey | AVRYXOPJQYNCBO-YTYFACEESA-N |
| XLogP | 1.68 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|