C26H43N3O7 — CID 143056199
methyl 2-[[(4S)-4-hydroxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidine-2-carbonyl]amino]hex-5-enoate (PubChem CID 143056199) has the molecular formula C26H43N3O7 and a molecular weight of 509.64 g/mol. Its IUPAC name is methyl 2-[[(4S)-4-hydroxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidine-2-carbonyl]amino]hex-5-enoate.
| Compound Name | methyl 2-[[(4S)-4-hydroxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidine-2-carbonyl]amino]hex-5-enoate |
|---|---|
| PubChem CID | 143056199 |
| Molecular Formula | C26H43N3O7 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | methyl 2-[[(4S)-4-hydroxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]pyrrolidine-2-carbonyl]amino]hex-5-enoate |
| SMILES | C=CCCCCCC(NC(=O)OC(C)(C)C)C(=O)N1C[C@@H](O)CC1C(=O)NC(CCC=C)C(=O)OC |
| InChI | InChI=1S/C26H43N3O7/c1-7-9-11-12-13-15-19(28-25(34)36-26(3,4)5)23(32)29-17-18(30)16-21(29)22(31)27-20(14-10-8-2)24(33)35-6/h7-8,18-21,30H,1-2,9-17H2,3-6H3,(H,27,31)(H,28,34)/t18-,19?,20?,21?/m0/s1 |
| InChIKey | ZZESVFZFDNRYJV-PCMKAUBLSA-N |
| XLogP | 2.60 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|