C26H47N3O7Si — CID 77439054
methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-(2-trimethylsilylethoxycarbonylamino)non-8-enoyl]pyrrolidine-2-carboxylate (PubChem CID 77439054) has the molecular formula C26H47N3O7Si and a molecular weight of 541.76 g/mol. Its IUPAC name is methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-(2-trimethylsilylethoxycarbonylamino)non-8-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-(2-trimethylsilylethoxycarbonylamino)non-8-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 77439054 |
| Molecular Formula | C26H47N3O7Si |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-[2-(2-trimethylsilylethoxycarbonylamino)non-8-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCCCCCC(NC(=O)OCC[Si](C)(C)C)C(=O)N1CC(NC(=O)OC(C)(C)C)CC1C(=O)OC |
| InChI | InChI=1S/C26H47N3O7Si/c1-9-10-11-12-13-14-20(28-24(32)35-15-16-37(6,7)8)22(30)29-18-19(17-21(29)23(31)34-5)27-25(33)36-26(2,3)4/h9,19-21H,1,10-18H2,2-8H3,(H,27,33)(H,28,32) |
| InChIKey | VKOUOZSEZHMYTQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|