C33H44N2O6 — CID 59386564
methyl (2S,4R)-4-methoxy-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylate (PubChem CID 59386564) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is methyl (2S,4R)-4-methoxy-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-methoxy-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59386564 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | methyl (2S,4R)-4-methoxy-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylate |
| SMILES | C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@](OC)(c2ccc(-c3ccccc3)cc2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C33H44N2O6/c1-7-8-9-10-14-17-27(34-31(38)41-32(2,3)4)29(36)35-23-33(40-6,22-28(35)30(37)39-5)26-20-18-25(19-21-26)24-15-12-11-13-16-24/h7,11-13,15-16,18-21,27-28H,1,8-10,14,17,22-23H2,2-6H3,(H,34,38)/t27-,28-,33-/m0/s1 |
| InChIKey | TUCDLGLRCPMSKF-DRVYDUGISA-N |
| XLogP | 6.00 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|