C32H40N2O6 — CID 67241411
methyl 1-[(2S)-2-(but-3-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-[3-(3-ethenylphenyl)phenyl]-4-methoxypyrrolidine-2-carboxylate (PubChem CID 67241411) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is methyl 1-[(2S)-2-(but-3-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-[3-(3-ethenylphenyl)phenyl]-4-methoxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(2S)-2-(but-3-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-[3-(3-ethenylphenyl)phenyl]-4-methoxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67241411 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | methyl 1-[(2S)-2-(but-3-enoxycarbonylamino)-3,3-dimethylbutanoyl]-4-[3-(3-ethenylphenyl)phenyl]-4-methoxypyrrolidine-2-carboxylate |
| SMILES | C=CCCOC(=O)N[C@H](C(=O)N1CC(OC)(c2cccc(-c3cccc(C=C)c3)c2)CC1C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C32H40N2O6/c1-8-10-17-40-30(37)33-27(31(3,4)5)28(35)34-21-32(39-7,20-26(34)29(36)38-6)25-16-12-15-24(19-25)23-14-11-13-22(9-2)18-23/h8-9,11-16,18-19,26-27H,1-2,10,17,20-21H2,3-7H3,(H,33,37)/t26?,27-,32?/m1/s1 |
| InChIKey | DLPAZKXPCPDZPK-OYUWRPJOSA-N |
| XLogP | 5.33 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|