C33H42N2O5 — CID 89078979
hex-5-enyl N-[(2S)-1-[(2S,4R)-4-[4-(2-ethenylphenyl)phenyl]-2-formyl-4-methoxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 89078979) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is hex-5-enyl N-[(2S)-1-[(2S,4R)-4-[4-(2-ethenylphenyl)phenyl]-2-formyl-4-methoxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | hex-5-enyl N-[(2S)-1-[(2S,4R)-4-[4-(2-ethenylphenyl)phenyl]-2-formyl-4-methoxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89078979 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | hex-5-enyl N-[(2S)-1-[(2S,4R)-4-[4-(2-ethenylphenyl)phenyl]-2-formyl-4-methoxypyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CCCCCOC(=O)N[C@H](C(=O)N1C[C@](OC)(c2ccc(-c3ccccc3C=C)cc2)C[C@H]1C=O)C(C)(C)C |
| InChI | InChI=1S/C33H42N2O5/c1-7-9-10-13-20-40-31(38)34-29(32(3,4)5)30(37)35-23-33(39-6,21-27(35)22-36)26-18-16-25(17-19-26)28-15-12-11-14-24(28)8-2/h7-8,11-12,14-19,22,27,29H,1-2,9-10,13,20-21,23H2,3-6H3,(H,34,38)/t27-,29+,33-/m0/s1 |
| InChIKey | XFERNBVEOQFZFA-UFPFOHJASA-N |
| XLogP | 6.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|