C32H42N2O7 — CID 67259674
4-(7-ethenyl-6-methoxynaphthalen-2-yl)-1-[(2S)-2-(hex-5-enoxycarbonylamino)-3,3-dimethylpentanoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 67259674) has the molecular formula C32H42N2O7 and a molecular weight of 566.70 g/mol. Its IUPAC name is 4-(7-ethenyl-6-methoxynaphthalen-2-yl)-1-[(2S)-2-(hex-5-enoxycarbonylamino)-3,3-dimethylpentanoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 4-(7-ethenyl-6-methoxynaphthalen-2-yl)-1-[(2S)-2-(hex-5-enoxycarbonylamino)-3,3-dimethylpentanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67259674 |
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 4-(7-ethenyl-6-methoxynaphthalen-2-yl)-1-[(2S)-2-(hex-5-enoxycarbonylamino)-3,3-dimethylpentanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | C=CCCCCOC(=O)N[C@H](C(=O)N1CC(O)(c2ccc3cc(OC)c(C=C)cc3c2)CC1C(=O)O)C(C)(C)CC |
| InChI | InChI=1S/C32H42N2O7/c1-7-10-11-12-15-41-30(38)33-27(31(4,5)9-3)28(35)34-20-32(39,19-25(34)29(36)37)24-14-13-22-18-26(40-6)21(8-2)16-23(22)17-24/h7-8,13-14,16-18,25,27,39H,1-2,9-12,15,19-20H2,3-6H3,(H,33,38)(H,36,37)/t25?,27-,32?/m1/s1 |
| InChIKey | QABHWBKKIQNZEO-GIIOTAEPSA-N |
| XLogP | 5.25 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|