C34H47N3O5S — CID 118630373
(2S,4R)-4-butylsulfanyl-1-[(2R)-2-(hex-5-enylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 118630373) has the molecular formula C34H47N3O5S and a molecular weight of 609.83 g/mol. Its IUPAC name is (2S,4R)-4-butylsulfanyl-1-[(2R)-2-(hex-5-enylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-butylsulfanyl-1-[(2R)-2-(hex-5-enylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118630373 |
| Molecular Formula | C34H47N3O5S |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | (2S,4R)-4-butylsulfanyl-1-[(2R)-2-(hex-5-enylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-(4-phenylphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | C=CCCCCN[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@](SCCCC)(c2ccc(-c3ccccc3)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C34H47N3O5S/c1-6-8-10-14-21-35-29(36-32(41)42-33(3,4)5)30(38)37-24-34(43-22-9-7-2,23-28(37)31(39)40)27-19-17-26(18-20-27)25-15-12-11-13-16-25/h6,11-13,15-20,28-29,35H,1,7-10,14,21-24H2,2-5H3,(H,36,41)(H,39,40)/t28-,29+,34-/m0/s1 |
| InChIKey | ASRLTEJDRGPHTI-ZZMKVXQQSA-N |
| XLogP | 6.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|