C36H48N2O5S — CID 67443581
methyl (2S,4R)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]dec-9-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate (PubChem CID 67443581) has the molecular formula C36H48N2O5S and a molecular weight of 620.86 g/mol. Its IUPAC name is methyl (2S,4R)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]dec-9-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]dec-9-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67443581 |
| Molecular Formula | C36H48N2O5S |
| Molecular Weight | 620.86 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | methyl (2S,4R)-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]dec-9-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
| SMILES | C=CCCCCCCC(NC(=O)OC(C)(C)C)C(=O)N1C[C@](SCC=C)(c2ccc(-c3ccccc3)cc2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C36H48N2O5S/c1-7-9-10-11-12-16-19-30(37-34(41)43-35(3,4)5)32(39)38-26-36(44-24-8-2,25-31(38)33(40)42-6)29-22-20-28(21-23-29)27-17-14-13-15-18-27/h7-8,13-15,17-18,20-23,30-31H,1-2,9-12,16,19,24-26H2,3-6H3,(H,37,41)/t30?,31-,36-/m0/s1 |
| InChIKey | QHMBBPKVWOXKJV-ZIPUCJQBSA-N |
| XLogP | 7.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.86 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|