C21H23NO2S — CID 67030849
methyl 4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate (PubChem CID 67030849) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is methyl 4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67030849 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | methyl 4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
| SMILES | C=CCSC1(c2ccc(-c3ccccc3)cc2)CNC(C(=O)OC)C1 |
| InChI | InChI=1S/C21H23NO2S/c1-3-13-25-21(14-19(22-15-21)20(23)24-2)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h3-12,19,22H,1,13-15H2,2H3 |
| InChIKey | LLHDWDMMAJHSEG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|