C19H19NO5 — CID 67051500
4-hydroxy-2-methoxycarbonyl-4-(4-phenylphenyl)pyrrolidine-1-carboxylic acid (PubChem CID 67051500) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-hydroxy-2-methoxycarbonyl-4-(4-phenylphenyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 4-hydroxy-2-methoxycarbonyl-4-(4-phenylphenyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67051500 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-hydroxy-2-methoxycarbonyl-4-(4-phenylphenyl)pyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)C1CC(O)(c2ccc(-c3ccccc3)cc2)CN1C(=O)O |
| InChI | InChI=1S/C19H19NO5/c1-25-17(21)16-11-19(24,12-20(16)18(22)23)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-10,16,24H,11-12H2,1H3,(H,22,23) |
| InChIKey | ILWJONRFPWOEBS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |