C35H46N2O5S — CID 59269826
methyl (2S,4R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate (PubChem CID 59269826) has the molecular formula C35H46N2O5S and a molecular weight of 606.83 g/mol. Its IUPAC name is methyl (2S,4R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59269826 |
| Molecular Formula | C35H46N2O5S |
| Molecular Weight | 606.83 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | methyl (2S,4R)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]-4-(4-phenylphenyl)-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
| SMILES | C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@](SCC=C)(c2ccc(-c3ccccc3)cc2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C35H46N2O5S/c1-7-9-10-11-15-18-29(36-33(40)42-34(3,4)5)31(38)37-25-35(43-23-8-2,24-30(37)32(39)41-6)28-21-19-27(20-22-28)26-16-13-12-14-17-26/h7-8,12-14,16-17,19-22,29-30H,1-2,9-11,15,18,23-25H2,3-6H3,(H,36,40)/t29-,30-,35-/m0/s1 |
| InChIKey | PFPYIYGMJKIWHO-BQXSUFNCSA-N |
| XLogP | 7.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.83 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|