C32H42N2O6 — CID 68800733
4-methoxy-1-[(2S,4R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-phenylphenyl)non-8-enoyl]pyrrolidine-2-carboxylic acid (PubChem CID 68800733) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is 4-methoxy-1-[(2S,4R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-phenylphenyl)non-8-enoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-methoxy-1-[(2S,4R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-phenylphenyl)non-8-enoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68800733 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | 4-methoxy-1-[(2S,4R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-phenylphenyl)non-8-enoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=CCCC[C@H](C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC(OC)CC1C(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H42N2O6/c1-6-7-9-14-25(24-17-15-23(16-18-24)22-12-10-8-11-13-22)19-27(33-31(38)40-32(2,3)4)29(35)34-21-26(39-5)20-28(34)30(36)37/h6,8,10-13,15-18,25-28H,1,7,9,14,19-21H2,2-5H3,(H,33,38)(H,36,37)/t25-,26?,27+,28?/m1/s1 |
| InChIKey | PXVNFNRFUBQYJC-PXIZKRJNSA-N |
| XLogP | 5.78 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|