C25H47N3O5Si — CID 70299639
tert-butyl N-[(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-carbamoylpyrrolidin-1-yl]-1-oxonon-8-en-2-yl]carbamate (PubChem CID 70299639) has the molecular formula C25H47N3O5Si and a molecular weight of 497.75 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-carbamoylpyrrolidin-1-yl]-1-oxonon-8-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-carbamoylpyrrolidin-1-yl]-1-oxonon-8-en-2-yl]carbamate |
|---|---|
| PubChem CID | 70299639 |
| Molecular Formula | C25H47N3O5Si |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-carbamoylpyrrolidin-1-yl]-1-oxonon-8-en-2-yl]carbamate |
| SMILES | C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(N)=O |
| InChI | InChI=1S/C25H47N3O5Si/c1-10-11-12-13-14-15-19(27-23(31)32-24(2,3)4)22(30)28-17-18(16-20(28)21(26)29)33-34(8,9)25(5,6)7/h10,18-20H,1,11-17H2,2-9H3,(H2,26,29)(H,27,31)/t18-,19+,20+/m1/s1 |
| InChIKey | BUSRWWXTHJZGRW-AABGKKOBSA-N |
| XLogP | 4.49 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|