C20H35N3O5 — CID 123235663
tert-butyl N-[1-(2-carbamoyl-4-hydroxypyrrolidin-1-yl)-3-methyl-1-oxonon-8-en-2-yl]carbamate (PubChem CID 123235663) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[1-(2-carbamoyl-4-hydroxypyrrolidin-1-yl)-3-methyl-1-oxonon-8-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-carbamoyl-4-hydroxypyrrolidin-1-yl)-3-methyl-1-oxonon-8-en-2-yl]carbamate |
|---|---|
| PubChem CID | 123235663 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | tert-butyl N-[1-(2-carbamoyl-4-hydroxypyrrolidin-1-yl)-3-methyl-1-oxonon-8-en-2-yl]carbamate |
| SMILES | C=CCCCCC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CC(O)CC1C(N)=O |
| InChI | InChI=1S/C20H35N3O5/c1-6-7-8-9-10-13(2)16(22-19(27)28-20(3,4)5)18(26)23-12-14(24)11-15(23)17(21)25/h6,13-16,24H,1,7-12H2,2-5H3,(H2,21,25)(H,22,27) |
| InChIKey | MDVGNHNSEUFYNU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|