C19H32N2O5 — CID 143750390
tert-butyl N-[(2S)-1-oxo-1-[(1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]non-8-en-2-yl]carbamate;molecular hydrogen (PubChem CID 143750390) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-[(1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]non-8-en-2-yl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-[(1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]non-8-en-2-yl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 143750390 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-[(1S,4S)-3-oxo-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]non-8-en-2-yl]carbamate;molecular hydrogen |
| SMILES | C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@@H]2C[C@H]1C(=O)O2.[H][H] |
| InChI | InChI=1S/C19H30N2O5.H2/c1-5-6-7-8-9-10-14(20-18(24)26-19(2,3)4)16(22)21-12-13-11-15(21)17(23)25-13;/h5,13-15H,1,6-12H2,2-4H3,(H,20,24);1H/t13-,14-,15-;/m0./s1 |
| InChIKey | DEXNNGSTUXKDMN-WDTSGDEMSA-N |
| XLogP | 2.79 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|