C22H36N2O5 — CID 76581487
methyl 6,6-dimethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 76581487) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl 6,6-dimethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl 6,6-dimethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 76581487 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | methyl 6,6-dimethyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C=CCCCCC(NC(=O)OC(C)(C)C)C(=O)N1CC2C(C1C(=O)OC)C2(C)C |
| InChI | InChI=1S/C22H36N2O5/c1-8-9-10-11-12-15(23-20(27)29-21(2,3)4)18(25)24-13-14-16(22(14,5)6)17(24)19(26)28-7/h8,14-17H,1,9-13H2,2-7H3,(H,23,27) |
| InChIKey | SIKPUAZXMXXSEV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|