C18H29NO3 — CID 58311058
methyl (1R,2S,5S)-6,6-dimethyl-3-[(2S)-2-methyloct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 58311058) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is methyl (1R,2S,5S)-6,6-dimethyl-3-[(2S)-2-methyloct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,2S,5S)-6,6-dimethyl-3-[(2S)-2-methyloct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 58311058 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | methyl (1R,2S,5S)-6,6-dimethyl-3-[(2S)-2-methyloct-7-enoyl]-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C=CCCCC[C@H](C)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)OC)C2(C)C |
| InChI | InChI=1S/C18H29NO3/c1-6-7-8-9-10-12(2)16(20)19-11-13-14(18(13,3)4)15(19)17(21)22-5/h6,12-15H,1,7-11H2,2-5H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | NLORRTCYFSNRSN-AJNGGQMLSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|