C32H42FN3O6 — CID 90059941
methyl (2'S,3S)-9-fluoro-5-methyl-1'-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]spiro[1,2-dihydropyrano[2,3-c]quinoline-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 90059941) has the molecular formula C32H42FN3O6 and a molecular weight of 583.70 g/mol. Its IUPAC name is methyl (2'S,3S)-9-fluoro-5-methyl-1'-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]spiro[1,2-dihydropyrano[2,3-c]quinoline-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | methyl (2'S,3S)-9-fluoro-5-methyl-1'-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]spiro[1,2-dihydropyrano[2,3-c]quinoline-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 90059941 |
| Molecular Formula | C32H42FN3O6 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | methyl (2'S,3S)-9-fluoro-5-methyl-1'-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoyl]spiro[1,2-dihydropyrano[2,3-c]quinoline-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@]2(CCc3c(c(C)nc4ccc(F)cc34)O2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C32H42FN3O6/c1-7-8-9-10-11-12-25(35-30(39)42-31(3,4)5)28(37)36-19-32(18-26(36)29(38)40-6)16-15-22-23-17-21(33)13-14-24(23)34-20(2)27(22)41-32/h7,13-14,17,25-26H,1,8-12,15-16,18-19H2,2-6H3,(H,35,39)/t25-,26-,32-/m0/s1 |
| InChIKey | LPGMEFYXFLDTOM-ZDQHWEPJSA-N |
| XLogP | 5.55 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|