C20H28N6O2 — CID 109433829
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(4-propan-2-yloxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 109433829) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(4-propan-2-yloxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(4-propan-2-yloxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433829 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(4-propan-2-yloxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(OC(C)C)cc1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C20H28N6O2/c1-15(2)28-18-7-5-16(6-8-18)11-22-20(21-3)25-9-10-26(19(27)14-25)17-12-23-24(4)13-17/h5-8,12-13,15H,9-11,14H2,1-4H3,(H,21,22) |
| InChIKey | APNXLXDPZKCUSS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|