C20H29IN6O3 — CID 109434556
N-[(4-ethoxy-3-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434556) has the molecular formula C20H29IN6O3 and a molecular weight of 528.40 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434556 |
| Molecular Formula | C20H29IN6O3 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1ccc(CN/C(=N\C)N2CCN(c3cnn(C)c3)C(=O)C2)cc1OC.I |
| InChI | InChI=1S/C20H28N6O3.HI/c1-5-29-17-7-6-15(10-18(17)28-4)11-22-20(21-2)25-8-9-26(19(27)14-25)16-12-23-24(3)13-16;/h6-7,10,12-13H,5,8-9,11,14H2,1-4H3,(H,21,22);1H |
| InChIKey | ZANPJFLAXNRCIB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|