C23H33IN6O3 — CID 109433870
N-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109433870) has the molecular formula C23H33IN6O3 and a molecular weight of 568.46 g/mol. Its IUPAC name is N-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109433870 |
| Molecular Formula | C23H33IN6O3 |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | N-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)c(OC2CCCC2)c1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C23H32N6O3.HI/c1-24-23(28-10-11-29(22(30)16-28)18-14-26-27(2)15-18)25-13-17-8-9-20(31-3)21(12-17)32-19-6-4-5-7-19;/h8-9,12,14-15,19H,4-7,10-11,13,16H2,1-3H3,(H,24,25);1H |
| InChIKey | NTFWADULWWDPNI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|