C16H22N6OS — CID 109433733
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(2-thiophen-3-ylethyl)piperazine-1-carboximidamide (PubChem CID 109433733) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(2-thiophen-3-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(2-thiophen-3-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433733 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(2-thiophen-3-ylethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1ccsc1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C16H22N6OS/c1-17-16(18-5-3-13-4-8-24-12-13)21-6-7-22(15(23)11-21)14-9-19-20(2)10-14/h4,8-10,12H,3,5-7,11H2,1-2H3,(H,17,18) |
| InChIKey | YSPXSWYBQHYTOZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|