C16H24IN7OS — CID 109436326
N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109436326) has the molecular formula C16H24IN7OS and a molecular weight of 489.39 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109436326 |
| Molecular Formula | C16H24IN7OS |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ncc(C)s1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C16H23N7OS.HI/c1-12-8-19-14(25-12)4-5-18-16(17-2)22-6-7-23(15(24)11-22)13-9-20-21(3)10-13;/h8-10H,4-7,11H2,1-3H3,(H,17,18);1H |
| InChIKey | NFPHIKXBQQJIRA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|