C17H26IN7O3S2 — CID 109434308
N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434308) has the molecular formula C17H26IN7O3S2 and a molecular weight of 567.48 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434308 |
| Molecular Formula | C17H26IN7O3S2 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1ccc(C)s1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C17H25N7O3S2.HI/c1-13-4-5-16(28-13)29(26,27)21-7-6-19-17(18-2)23-8-9-24(15(25)12-23)14-10-20-22(3)11-14;/h4-5,10-11,21H,6-9,12H2,1-3H3,(H,18,19);1H |
| InChIKey | GGOFKYOUCBSSPJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|