C14H31IN4O — CID 111735948
N-[2-(diethylamino)ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111735948) has the molecular formula C14H31IN4O and a molecular weight of 398.33 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111735948 |
| Molecular Formula | C14H31IN4O |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC)CCN/C(=N\C)N1CCC(COC)C1.I |
| InChI | InChI=1S/C14H30N4O.HI/c1-5-17(6-2)10-8-16-14(15-3)18-9-7-13(11-18)12-19-4;/h13H,5-12H2,1-4H3,(H,15,16);1H |
| InChIKey | AAIZGQMEOZTLSN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|