C15H30N4O4S — CID 111252677
methyl 1-[N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252677) has the molecular formula C15H30N4O4S and a molecular weight of 362.50 g/mol. Its IUPAC name is methyl 1-[N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252677 |
| Molecular Formula | C15H30N4O4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl 1-[N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N\C)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H30N4O4S/c1-5-24(21,22)18(3)10-6-9-17-15(16-2)19-11-7-13(8-12-19)14(20)23-4/h13H,5-12H2,1-4H3,(H,16,17) |
| InChIKey | DUZLEFAWSLYLFX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|