C20H40IN5O4 — CID 111748619
2-[[[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111748619) has the molecular formula C20H40IN5O4 and a molecular weight of 541.48 g/mol. Its IUPAC name is 2-[[[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111748619 |
| Molecular Formula | C20H40IN5O4 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 2-[[[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCOCC1CCN(/C(=N\CC(=O)N(C)C)NCCCN2CCOCC2)C1.I |
| InChI | InChI=1S/C20H39N5O4.HI/c1-23(2)19(26)15-22-20(21-6-4-7-24-9-11-28-12-10-24)25-8-5-18(16-25)17-29-14-13-27-3;/h18H,4-17H2,1-3H3,(H,21,22);1H |
| InChIKey | VBFGJCFWQXALEV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|