C16H17N3O — CID 127041506
1,4-diazabicyclo[3.2.1]octan-4-yl(quinolin-6-yl)methanone (PubChem CID 127041506) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 1,4-diazabicyclo[3.2.1]octan-4-yl(quinolin-6-yl)methanone.
| Compound Name | 1,4-diazabicyclo[3.2.1]octan-4-yl(quinolin-6-yl)methanone |
|---|---|
| PubChem CID | 127041506 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1,4-diazabicyclo[3.2.1]octan-4-yl(quinolin-6-yl)methanone |
| SMILES | O=C(c1ccc2ncccc2c1)N1CCN2CCC1C2 |
| InChI | InChI=1S/C16H17N3O/c20-16(19-9-8-18-7-5-14(19)11-18)13-3-4-15-12(10-13)2-1-6-17-15/h1-4,6,10,14H,5,7-9,11H2 |
| InChIKey | RBRIMPSGXOYPKW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |