C17H19N3O — CID 127041508
1,4-diazabicyclo[3.2.2]nonan-4-yl(quinolin-6-yl)methanone (PubChem CID 127041508) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1,4-diazabicyclo[3.2.2]nonan-4-yl(quinolin-6-yl)methanone.
| Compound Name | 1,4-diazabicyclo[3.2.2]nonan-4-yl(quinolin-6-yl)methanone |
|---|---|
| PubChem CID | 127041508 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1,4-diazabicyclo[3.2.2]nonan-4-yl(quinolin-6-yl)methanone |
| SMILES | O=C(c1ccc2ncccc2c1)N1CCN2CCC1CC2 |
| InChI | InChI=1S/C17H19N3O/c21-17(20-11-10-19-8-5-15(20)6-9-19)14-3-4-16-13(12-14)2-1-7-18-16/h1-4,7,12,15H,5-6,8-11H2 |
| InChIKey | DHIPLVZUPFZEKD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |