C20H27NO4 — CID 122151886
2-(3-acetylphenoxy)-1-[2-(2-hydroxycyclopentyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 122151886) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-1-[2-(2-hydroxycyclopentyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2-(3-acetylphenoxy)-1-[2-(2-hydroxycyclopentyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122151886 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-(3-acetylphenoxy)-1-[2-(2-hydroxycyclopentyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(=O)c1cccc(OC(C)C(=O)N2CCCC2C2CCCC2O)c1 |
| InChI | InChI=1S/C20H27NO4/c1-13(22)15-6-3-7-16(12-15)25-14(2)20(24)21-11-5-9-18(21)17-8-4-10-19(17)23/h3,6-7,12,14,17-19,23H,4-5,8-11H2,1-2H3 |
| InChIKey | MWBVQVLVWQQURT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |