C25H29ClN2O2 — CID 60564252
[4-(3-chlorophenyl)oxan-4-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone (PubChem CID 60564252) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is [4-(3-chlorophenyl)oxan-4-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone.
| Compound Name | [4-(3-chlorophenyl)oxan-4-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60564252 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [4-(3-chlorophenyl)oxan-4-yl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(C/C=C/c2ccccc2)CC1)C1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C25H29ClN2O2/c26-23-10-4-9-22(20-23)25(11-18-30-19-12-25)24(29)28-16-14-27(15-17-28)13-5-8-21-6-2-1-3-7-21/h1-10,20H,11-19H2/b8-5+ |
| InChIKey | AMZVWNDHBTWONM-VMPITWQZSA-N |
| XLogP | 4.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |