C23H25F2N3O2 — CID 55599636
N-(4-fluorophenyl)-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperazine-1-carboxamide (PubChem CID 55599636) has the molecular formula C23H25F2N3O2 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperazine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55599636 |
| Molecular Formula | C23H25F2N3O2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(4-fluorophenyl)-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CCN(C(=O)C2(c3cccc(F)c3)CCCC2)CC1 |
| InChI | InChI=1S/C23H25F2N3O2/c24-18-6-8-20(9-7-18)26-22(30)28-14-12-27(13-15-28)21(29)23(10-1-2-11-23)17-4-3-5-19(25)16-17/h3-9,16H,1-2,10-15H2,(H,26,30) |
| InChIKey | XSXFHXOFDTUJCY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |