C21H26FNO3 — CID 119174632
6-[1-(3-fluorophenyl)cyclohexanecarbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119174632) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is 6-[1-(3-fluorophenyl)cyclohexanecarbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[1-(3-fluorophenyl)cyclohexanecarbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 119174632 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 6-[1-(3-fluorophenyl)cyclohexanecarbonyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | O=C(O)C1CC12CCN(C(=O)C1(c3cccc(F)c3)CCCCC1)CC2 |
| InChI | InChI=1S/C21H26FNO3/c22-16-6-4-5-15(13-16)21(7-2-1-3-8-21)19(26)23-11-9-20(10-12-23)14-17(20)18(24)25/h4-6,13,17H,1-3,7-12,14H2,(H,24,25) |
| InChIKey | RDJZDIBTHNPNPB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |