C16H17BrFNO3 — CID 119258301
1-[1-(4-bromophenyl)cyclobutanecarbonyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119258301) has the molecular formula C16H17BrFNO3 and a molecular weight of 370.22 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)cyclobutanecarbonyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(4-bromophenyl)cyclobutanecarbonyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119258301 |
| Molecular Formula | C16H17BrFNO3 |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 1-[1-(4-bromophenyl)cyclobutanecarbonyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(F)CCN(C(=O)C2(c3ccc(Br)cc3)CCC2)C1 |
| InChI | InChI=1S/C16H17BrFNO3/c17-12-4-2-11(3-5-12)15(6-1-7-15)13(20)19-9-8-16(18,10-19)14(21)22/h2-5H,1,6-10H2,(H,21,22) |
| InChIKey | WYIDOSUKOCPRMA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |