C18H25BrN2O — CID 120807621
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone (PubChem CID 120807621) has the molecular formula C18H25BrN2O and a molecular weight of 365.32 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 120807621 |
| Molecular Formula | C18H25BrN2O |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-bromophenyl)cyclopentyl]methanone |
| SMILES | CC1(CN)CCN(C(=O)C2(c3ccc(Br)cc3)CCCC2)C1 |
| InChI | InChI=1S/C18H25BrN2O/c1-17(12-20)10-11-21(13-17)16(22)18(8-2-3-9-18)14-4-6-15(19)7-5-14/h4-7H,2-3,8-13,20H2,1H3 |
| InChIKey | YBIUENBHPCTKKM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |