C19H27ClN2O — CID 120810169
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone (PubChem CID 120810169) has the molecular formula C19H27ClN2O and a molecular weight of 334.89 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 120810169 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-[1-(4-chlorophenyl)cyclohexyl]methanone |
| SMILES | CC1(CN)CCN(C(=O)C2(c3ccc(Cl)cc3)CCCCC2)C1 |
| InChI | InChI=1S/C19H27ClN2O/c1-18(13-21)11-12-22(14-18)17(23)19(9-3-2-4-10-19)15-5-7-16(20)8-6-15/h5-8H,2-4,9-14,21H2,1H3 |
| InChIKey | FKFUHDNXRSFMER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |