C18H24ClNO2 — CID 66661540
(3-tert-butyl-3-hydroxypyrrolidin-1-yl)-[1-(4-chlorophenyl)cyclopropyl]methanone (PubChem CID 66661540) has the molecular formula C18H24ClNO2 and a molecular weight of 321.85 g/mol. Its IUPAC name is (3-tert-butyl-3-hydroxypyrrolidin-1-yl)-[1-(4-chlorophenyl)cyclopropyl]methanone.
| Compound Name | (3-tert-butyl-3-hydroxypyrrolidin-1-yl)-[1-(4-chlorophenyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 66661540 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (3-tert-butyl-3-hydroxypyrrolidin-1-yl)-[1-(4-chlorophenyl)cyclopropyl]methanone |
| SMILES | CC(C)(C)C1(O)CCN(C(=O)C2(c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C18H24ClNO2/c1-16(2,3)18(22)10-11-20(12-18)15(21)17(8-9-17)13-4-6-14(19)7-5-13/h4-7,22H,8-12H2,1-3H3 |
| InChIKey | GBAOKTRPDHZUSL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |