C22H22N2O3S2 — CID 53124548
[5-(4-methylphenyl)sulfonylthiophen-2-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 53124548) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is [5-(4-methylphenyl)sulfonylthiophen-2-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [5-(4-methylphenyl)sulfonylthiophen-2-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 53124548 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [5-(4-methylphenyl)sulfonylthiophen-2-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C(=O)N3CCN(c4ccccc4)CC3)s2)cc1 |
| InChI | InChI=1S/C22H22N2O3S2/c1-17-7-9-19(10-8-17)29(26,27)21-12-11-20(28-21)22(25)24-15-13-23(14-16-24)18-5-3-2-4-6-18/h2-12H,13-16H2,1H3 |
| InChIKey | PTBIKMSLWNYZNP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |