C17H20N2O3S2 — CID 20958443
N-[(4-methylphenyl)methyl]-5-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide (PubChem CID 20958443) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-5-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide.
| Compound Name | N-[(4-methylphenyl)methyl]-5-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20958443 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-5-(pyrrolidine-1-carbonyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2ccc(C(=O)N3CCCC3)s2)cc1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-13-4-6-14(7-5-13)12-18-24(21,22)16-9-8-15(23-16)17(20)19-10-2-3-11-19/h4-9,18H,2-3,10-12H2,1H3 |
| InChIKey | WGBAGIHRTJRACW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |