C20H20F3NOS — CID 24720307
N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 24720307) has the molecular formula C20H20F3NOS and a molecular weight of 379.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24720307 |
| Molecular Formula | C20H20F3NOS |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H20F3NOS/c21-20(22,23)16-8-4-7-15(13-16)17-9-10-18(26-17)19(25)24-12-11-14-5-2-1-3-6-14/h4-5,7-10,13H,1-3,6,11-12H2,(H,24,25) |
| InChIKey | HMKCLTQPHACYFO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|