C25H23F3N2O2 — CID 69441277
N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide (PubChem CID 69441277) has the molecular formula C25H23F3N2O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 69441277 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1-[3-(trifluoromethyl)phenyl]quinoline-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc2ccccc2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C25H23F3N2O2/c26-25(27,28)19-10-6-11-20(16-19)30-22-12-5-4-9-18(22)15-21(24(30)32)23(31)29-14-13-17-7-2-1-3-8-17/h4-7,9-12,15-16H,1-3,8,13-14H2,(H,29,31) |
| InChIKey | LQJDAPWFGDHUEF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|